C17H14ClFN4O2 — CID 110180901
7-chloro-N-ethyl-5-(2-fluorophenyl)-2-oxo-3H-pyrido[3,2-e][1,4]diazepine-1-carboxamide (PubChem CID 110180901) has the molecular formula C17H14ClFN4O2 and a molecular weight of 360.78 g/mol. Its IUPAC name is 7-chloro-N-ethyl-5-(2-fluorophenyl)-2-oxo-3H-pyrido[3,2-e][1,4]diazepine-1-carboxamide.
| Compound Name | 7-chloro-N-ethyl-5-(2-fluorophenyl)-2-oxo-3H-pyrido[3,2-e][1,4]diazepine-1-carboxamide |
|---|---|
| PubChem CID | 110180901 |
| Molecular Formula | C17H14ClFN4O2 |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 7-chloro-N-ethyl-5-(2-fluorophenyl)-2-oxo-3H-pyrido[3,2-e][1,4]diazepine-1-carboxamide |
| SMILES | CCNC(=O)N1C(=O)CN=C(c2ccccc2F)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C17H14ClFN4O2/c1-2-20-17(25)23-12-7-8-13(18)22-16(12)15(21-9-14(23)24)10-5-3-4-6-11(10)19/h3-8H,2,9H2,1H3,(H,20,25) |
| InChIKey | WPGNBEJZMGOKBH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|