C17H11Cl2N3O — CID 110181149
7-chloro-5-(2-chlorophenyl)-1-prop-2-ynyl-3H-pyrido[3,2-e][1,4]diazepin-2-one (PubChem CID 110181149) has the molecular formula C17H11Cl2N3O and a molecular weight of 344.20 g/mol. Its IUPAC name is 7-chloro-5-(2-chlorophenyl)-1-prop-2-ynyl-3H-pyrido[3,2-e][1,4]diazepin-2-one.
| Compound Name | 7-chloro-5-(2-chlorophenyl)-1-prop-2-ynyl-3H-pyrido[3,2-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 110181149 |
| Molecular Formula | C17H11Cl2N3O |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 7-chloro-5-(2-chlorophenyl)-1-prop-2-ynyl-3H-pyrido[3,2-e][1,4]diazepin-2-one |
| SMILES | C#CCN1C(=O)CN=C(c2ccccc2Cl)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C17H11Cl2N3O/c1-2-9-22-13-7-8-14(19)21-17(13)16(20-10-15(22)23)11-5-3-4-6-12(11)18/h1,3-8H,9-10H2 |
| InChIKey | NQLFIUAMBLCLPX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|