C18H13Cl2N3O4 — CID 110180622
[1-acetyl-7-chloro-5-(2-chlorophenyl)-2-oxo-3H-pyrido[3,2-e][1,4]diazepin-3-yl] acetate (PubChem CID 110180622) has the molecular formula C18H13Cl2N3O4 and a molecular weight of 406.23 g/mol. Its IUPAC name is [1-acetyl-7-chloro-5-(2-chlorophenyl)-2-oxo-3H-pyrido[3,2-e][1,4]diazepin-3-yl] acetate.
| Compound Name | [1-acetyl-7-chloro-5-(2-chlorophenyl)-2-oxo-3H-pyrido[3,2-e][1,4]diazepin-3-yl] acetate |
|---|---|
| PubChem CID | 110180622 |
| Molecular Formula | C18H13Cl2N3O4 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | [1-acetyl-7-chloro-5-(2-chlorophenyl)-2-oxo-3H-pyrido[3,2-e][1,4]diazepin-3-yl] acetate |
| SMILES | CC(=O)OC1N=C(c2ccccc2Cl)c2nc(Cl)ccc2N(C(C)=O)C1=O |
| InChI | InChI=1S/C18H13Cl2N3O4/c1-9(24)23-13-7-8-14(20)21-16(13)15(11-5-3-4-6-12(11)19)22-17(18(23)26)27-10(2)25/h3-8,17H,1-2H3 |
| InChIKey | OGAHUEVSKIVFRF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|