C20H14Cl2N4O — CID 110181348
3-anilino-7-chloro-5-(2-chlorophenyl)-1,3-dihydropyrido[3,2-e][1,4]diazepin-2-one (PubChem CID 110181348) has the molecular formula C20H14Cl2N4O and a molecular weight of 397.27 g/mol. Its IUPAC name is 3-anilino-7-chloro-5-(2-chlorophenyl)-1,3-dihydropyrido[3,2-e][1,4]diazepin-2-one.
| Compound Name | 3-anilino-7-chloro-5-(2-chlorophenyl)-1,3-dihydropyrido[3,2-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 110181348 |
| Molecular Formula | C20H14Cl2N4O |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 3-anilino-7-chloro-5-(2-chlorophenyl)-1,3-dihydropyrido[3,2-e][1,4]diazepin-2-one |
| SMILES | O=C1Nc2ccc(Cl)nc2C(c2ccccc2Cl)=NC1Nc1ccccc1 |
| InChI | InChI=1S/C20H14Cl2N4O/c21-14-9-5-4-8-13(14)17-18-15(10-11-16(22)25-18)24-20(27)19(26-17)23-12-6-2-1-3-7-12/h1-11,19,23H,(H,24,27) |
| InChIKey | WJPSUQRHSZVWBS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|