C21H21Cl2N4O+ — CID 110181289
12-chloro-9-(2-chlorophenyl)-4-[2-(dimethylamino)ethyl]-8,11-diaza-2-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),8,11,13-pentaen-3-one (PubChem CID 110181289) has the molecular formula C21H21Cl2N4O+ and a molecular weight of 416.33 g/mol. Its IUPAC name is 12-chloro-9-(2-chlorophenyl)-4-[2-(dimethylamino)ethyl]-8,11-diaza-2-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),8,11,13-pentaen-3-one.
| Compound Name | 12-chloro-9-(2-chlorophenyl)-4-[2-(dimethylamino)ethyl]-8,11-diaza-2-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),8,11,13-pentaen-3-one |
|---|---|
| PubChem CID | 110181289 |
| Molecular Formula | C21H21Cl2N4O+ |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 12-chloro-9-(2-chlorophenyl)-4-[2-(dimethylamino)ethyl]-8,11-diaza-2-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),8,11,13-pentaen-3-one |
| SMILES | CN(C)CCC1CC2=[N+](C1=O)c1ccc(Cl)nc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C21H21Cl2N4O/c1-26(2)10-9-13-11-14-12-24-19(15-5-3-4-6-16(15)22)20-17(27(14)21(13)28)7-8-18(23)25-20/h3-8,13H,9-12H2,1-2H3/q+1 |
| InChIKey | MORDMKJJBPFNFS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|