C19H19ClN4O — CID 110181032
5-(2-chlorophenyl)-7-(dimethylamino)-1-prop-2-enyl-3H-pyrido[3,2-e][1,4]diazepin-2-one (PubChem CID 110181032) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-(dimethylamino)-1-prop-2-enyl-3H-pyrido[3,2-e][1,4]diazepin-2-one.
| Compound Name | 5-(2-chlorophenyl)-7-(dimethylamino)-1-prop-2-enyl-3H-pyrido[3,2-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 110181032 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 5-(2-chlorophenyl)-7-(dimethylamino)-1-prop-2-enyl-3H-pyrido[3,2-e][1,4]diazepin-2-one |
| SMILES | C=CCN1C(=O)CN=C(c2ccccc2Cl)c2nc(N(C)C)ccc21 |
| InChI | InChI=1S/C19H19ClN4O/c1-4-11-24-15-9-10-16(23(2)3)22-19(15)18(21-12-17(24)25)13-7-5-6-8-14(13)20/h4-10H,1,11-12H2,2-3H3 |
| InChIKey | GJRKLBORQFRJOK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|