C16H11ClN6O2 — CID 176586487
9-(2-chlorophenyl)-3-methyl-12-nitro-2,4,5,8,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,8,11,13-hexaene (PubChem CID 176586487) has the molecular formula C16H11ClN6O2 and a molecular weight of 354.76 g/mol. Its IUPAC name is 9-(2-chlorophenyl)-3-methyl-12-nitro-2,4,5,8,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,8,11,13-hexaene.
| Compound Name | 9-(2-chlorophenyl)-3-methyl-12-nitro-2,4,5,8,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,8,11,13-hexaene |
|---|---|
| PubChem CID | 176586487 |
| Molecular Formula | C16H11ClN6O2 |
| Molecular Weight | 354.76 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 9-(2-chlorophenyl)-3-methyl-12-nitro-2,4,5,8,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,8,11,13-hexaene |
| SMILES | Cc1nnc2n1-c1ccc([N+](=O)[O-])nc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C16H11ClN6O2/c1-9-20-21-14-8-18-15(10-4-2-3-5-11(10)17)16-12(22(9)14)6-7-13(19-16)23(24)25/h2-7H,8H2,1H3 |
| InChIKey | KAHJTDISEBJARA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.76 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|