C15H11Cl2N3S — CID 110181326
7-chloro-5-(2-chlorophenyl)-2-methylsulfanyl-3H-pyrido[3,2-e][1,4]diazepine (PubChem CID 110181326) has the molecular formula C15H11Cl2N3S and a molecular weight of 336.25 g/mol. Its IUPAC name is 7-chloro-5-(2-chlorophenyl)-2-methylsulfanyl-3H-pyrido[3,2-e][1,4]diazepine.
| Compound Name | 7-chloro-5-(2-chlorophenyl)-2-methylsulfanyl-3H-pyrido[3,2-e][1,4]diazepine |
|---|---|
| PubChem CID | 110181326 |
| Molecular Formula | C15H11Cl2N3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 7-chloro-5-(2-chlorophenyl)-2-methylsulfanyl-3H-pyrido[3,2-e][1,4]diazepine |
| SMILES | CSC1=Nc2ccc(Cl)nc2C(c2ccccc2Cl)=NC1 |
| InChI | InChI=1S/C15H11Cl2N3S/c1-21-13-8-18-14(9-4-2-3-5-10(9)16)15-11(19-13)6-7-12(17)20-15/h2-7H,8H2,1H3 |
| InChIKey | UUMNXCGIPCIVAU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|