C20H19FN4O2 — CID 154414434
2-(aziridin-1-yl)-N-[5-(2-fluorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-7-yl]acetamide (PubChem CID 154414434) has the molecular formula C20H19FN4O2 and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-(aziridin-1-yl)-N-[5-(2-fluorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-7-yl]acetamide.
| Compound Name | 2-(aziridin-1-yl)-N-[5-(2-fluorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-7-yl]acetamide |
|---|---|
| PubChem CID | 154414434 |
| Molecular Formula | C20H19FN4O2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-(aziridin-1-yl)-N-[5-(2-fluorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-7-yl]acetamide |
| SMILES | CN1C(=O)CN=C(c2ccccc2F)c2cc(NC(=O)CN3CC3)ccc21 |
| InChI | InChI=1S/C20H19FN4O2/c1-24-17-7-6-13(23-18(26)12-25-8-9-25)10-15(17)20(22-11-19(24)27)14-4-2-3-5-16(14)21/h2-7,10H,8-9,11-12H2,1H3,(H,23,26) |
| InChIKey | GRTOQHGCWVZFOF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|