C17H10FN5O — CID 173429776
6-(2-fluorophenyl)-1-isocyanato-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 173429776) has the molecular formula C17H10FN5O and a molecular weight of 319.30 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-1-isocyanato-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 6-(2-fluorophenyl)-1-isocyanato-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 173429776 |
| Molecular Formula | C17H10FN5O |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 6-(2-fluorophenyl)-1-isocyanato-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | O=C=Nc1nnc2n1-c1ccccc1C(c1ccccc1F)=NC2 |
| InChI | InChI=1S/C17H10FN5O/c18-13-7-3-1-5-11(13)16-12-6-2-4-8-14(12)23-15(9-19-16)21-22-17(23)20-10-24/h1-8H,9H2 |
| InChIKey | WEJUQVQACPOEEM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|