C29H20FN5O2 — CID 67837924
2-[4-[6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]but-2-ynyl]isoindole-1,3-dione (PubChem CID 67837924) has the molecular formula C29H20FN5O2 and a molecular weight of 489.51 g/mol. Its IUPAC name is 2-[4-[6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]but-2-ynyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]but-2-ynyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67837924 |
| Molecular Formula | C29H20FN5O2 |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 2-[4-[6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]but-2-ynyl]isoindole-1,3-dione |
| SMILES | Cc1nnc2n1-c1ccc(CC#CCN3C(=O)c4ccccc4C3=O)cc1C(c1ccccc1F)=NC2 |
| InChI | InChI=1S/C29H20FN5O2/c1-18-32-33-26-17-31-27(22-11-4-5-12-24(22)30)23-16-19(13-14-25(23)35(18)26)8-6-7-15-34-28(36)20-9-2-3-10-21(20)29(34)37/h2-5,9-14,16H,8,15,17H2,1H3 |
| InChIKey | YQFKFDMPIPHHNX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|