C20H15FIN3O — CID 15079809
1-ethyl-7-(2-fluorophenyl)-9-iodo-5H-pyrimido[1,2-a][1,4]benzodiazepin-3-one (PubChem CID 15079809) has the molecular formula C20H15FIN3O and a molecular weight of 459.26 g/mol. Its IUPAC name is 1-ethyl-7-(2-fluorophenyl)-9-iodo-5H-pyrimido[1,2-a][1,4]benzodiazepin-3-one.
| Compound Name | 1-ethyl-7-(2-fluorophenyl)-9-iodo-5H-pyrimido[1,2-a][1,4]benzodiazepin-3-one |
|---|---|
| PubChem CID | 15079809 |
| Molecular Formula | C20H15FIN3O |
| Molecular Weight | 459.26 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | 1-ethyl-7-(2-fluorophenyl)-9-iodo-5H-pyrimido[1,2-a][1,4]benzodiazepin-3-one |
| SMILES | CCc1cc(=O)nc2n1-c1ccc(I)cc1C(c1ccccc1F)=NC2 |
| InChI | InChI=1S/C20H15FIN3O/c1-2-13-10-19(26)24-18-11-23-20(14-5-3-4-6-16(14)21)15-9-12(22)7-8-17(15)25(13)18/h3-10H,2,11H2,1H3 |
| InChIKey | BLDBXXJUEFDIBW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|