C23H26ClN5O — CID 21420466
N-[[6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methoxy]-N-propylpropan-1-amine (PubChem CID 21420466) has the molecular formula C23H26ClN5O and a molecular weight of 423.95 g/mol. Its IUPAC name is N-[[6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methoxy]-N-propylpropan-1-amine.
| Compound Name | N-[[6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methoxy]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 21420466 |
| Molecular Formula | C23H26ClN5O |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-[[6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methoxy]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)OCc1nnc2n1-c1ccccc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C23H26ClN5O/c1-3-13-28(14-4-2)30-16-22-27-26-21-15-25-23(17-9-5-7-11-19(17)24)18-10-6-8-12-20(18)29(21)22/h5-12H,3-4,13-16H2,1-2H3 |
| InChIKey | GBCKGXQETLNNQS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|