C19H13ClF3N5O — CID 88825402
N-[[6-(2-chlorophenyl)-8-(trifluoromethyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methoxy]methanimine (PubChem CID 88825402) has the molecular formula C19H13ClF3N5O and a molecular weight of 419.79 g/mol. Its IUPAC name is N-[[6-(2-chlorophenyl)-8-(trifluoromethyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methoxy]methanimine.
| Compound Name | N-[[6-(2-chlorophenyl)-8-(trifluoromethyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methoxy]methanimine |
|---|---|
| PubChem CID | 88825402 |
| Molecular Formula | C19H13ClF3N5O |
| Molecular Weight | 419.79 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-[[6-(2-chlorophenyl)-8-(trifluoromethyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methoxy]methanimine |
| SMILES | C=NOCc1nnc2n1-c1ccc(C(F)(F)F)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C19H13ClF3N5O/c1-24-29-10-17-27-26-16-9-25-18(12-4-2-3-5-14(12)20)13-8-11(19(21,22)23)6-7-15(13)28(16)17/h2-8H,1,9-10H2 |
| InChIKey | KRTODNLGRRZWHP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|