C16H12N2OS — CID 89276168
7-ethynyl-1-methyl-5-phenyl-3H-thieno[3,2-e][1,4]diazepin-2-one (PubChem CID 89276168) has the molecular formula C16H12N2OS and a molecular weight of 280.35 g/mol. Its IUPAC name is 7-ethynyl-1-methyl-5-phenyl-3H-thieno[3,2-e][1,4]diazepin-2-one.
| Compound Name | 7-ethynyl-1-methyl-5-phenyl-3H-thieno[3,2-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 89276168 |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 7-ethynyl-1-methyl-5-phenyl-3H-thieno[3,2-e][1,4]diazepin-2-one |
| SMILES | C#Cc1cc2c(s1)C(c1ccccc1)=NCC(=O)N2C |
| InChI | InChI=1S/C16H12N2OS/c1-3-12-9-13-16(20-12)15(11-7-5-4-6-8-11)17-10-14(19)18(13)2/h1,4-9H,10H2,2H3 |
| InChIKey | FSAOSPRKZKUNIF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|