C18H16N2O2 — CID 176646767
1-methyl-5-oxo-N,3-diphenyl-2H-pyrrole-4-carboxamide (PubChem CID 176646767) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-methyl-5-oxo-N,3-diphenyl-2H-pyrrole-4-carboxamide.
| Compound Name | 1-methyl-5-oxo-N,3-diphenyl-2H-pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 176646767 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-methyl-5-oxo-N,3-diphenyl-2H-pyrrole-4-carboxamide |
| SMILES | CN1CC(c2ccccc2)=C(C(=O)Nc2ccccc2)C1=O |
| InChI | InChI=1S/C18H16N2O2/c1-20-12-15(13-8-4-2-5-9-13)16(18(20)22)17(21)19-14-10-6-3-7-11-14/h2-11H,12H2,1H3,(H,19,21) |
| InChIKey | JKBOQSAMJSNRMM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|