C19H18N4O3 — CID 11727816
4-anilino-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboxamide (PubChem CID 11727816) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 4-anilino-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboxamide.
| Compound Name | 4-anilino-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11727816 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-anilino-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboxamide |
| SMILES | Cn1c(Nc2ccccc2)c(C(=O)Nc2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C19H18N4O3/c1-22-16(20-13-9-5-3-6-10-13)15(18(25)23(2)19(22)26)17(24)21-14-11-7-4-8-12-14/h3-12,20H,1-2H3,(H,21,24) |
| InChIKey | BSCJBFBYECPKAZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |