C13H12ClN3O3 — CID 11748395
4-chloro-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboxamide (PubChem CID 11748395) has the molecular formula C13H12ClN3O3 and a molecular weight of 293.71 g/mol. Its IUPAC name is 4-chloro-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboxamide.
| Compound Name | 4-chloro-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11748395 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4-chloro-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboxamide |
| SMILES | Cn1c(Cl)c(C(=O)Nc2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C13H12ClN3O3/c1-16-10(14)9(12(19)17(2)13(16)20)11(18)15-8-6-4-3-5-7-8/h3-7H,1-2H3,(H,15,18) |
| InChIKey | LAGODTCJJFFSBD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |