C17H12ClN2O3- — CID 134117203
4-[(4-chlorophenyl)carbamoyl]-2-methyl-1-oxoisoquinolin-3-olate (PubChem CID 134117203) has the molecular formula C17H12ClN2O3- and a molecular weight of 327.75 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)carbamoyl]-2-methyl-1-oxoisoquinolin-3-olate.
| Compound Name | 4-[(4-chlorophenyl)carbamoyl]-2-methyl-1-oxoisoquinolin-3-olate |
|---|---|
| PubChem CID | 134117203 |
| Molecular Formula | C17H12ClN2O3- |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 4-[(4-chlorophenyl)carbamoyl]-2-methyl-1-oxoisoquinolin-3-olate |
| SMILES | Cn1c([O-])c(C(=O)Nc2ccc(Cl)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C17H13ClN2O3/c1-20-16(22)13-5-3-2-4-12(13)14(17(20)23)15(21)19-11-8-6-10(18)7-9-11/h2-9,23H,1H3,(H,19,21)/p-1 |
| InChIKey | MQPIXXYWNVQVRE-UHFFFAOYSA-M |
| XLogP | 2.52 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |