About 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide
4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide (PubChem CID 70538135) has the molecular formula C21H20N2O4
and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide |
| PubChem CID | 70538135 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(=O)N(CCOc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C21H20N2O4/c1-15-14-18(24)23(12-13-27-17-10-6-3-7-11-17)21(26)19(15)20(25)22-16-8-4-2-5-9-16/h2-11H,12-14H2,1H3,(H,22,25) |
| InChIKey | NSPVYFSJORGESO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide?
The IUPAC name of 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide (CID 70538135) is 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide.
What is the SMILES notation for 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide?
The canonical SMILES for 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide is CC1=C(C(=O)Nc2ccccc2)C(=O)N(CCOc2ccccc2)C(=O)C1.
What is the InChIKey of 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide?
The InChIKey is NSPVYFSJORGESO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O4/c1-15-14-18(24)23(12-13-27-17-10-6-3-7-11-17)21(26)19(15)20(25)22-16-8-4-2-5-9-16/h2-11H,12-14H2,1H3,(H,22,25).
What are the key properties of 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide?
4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide has a molecular weight of 364.40 g/mol, XLogP of 2.78, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,6-dioxo-1-(2-phenoxyethyl)-N-phenyl-3H-pyridine-5-carboxamide is sourced from PubChem (CID 70538135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).