C25H28N2O6 — CID 54682796
8-[4-[(3-hydroxy-5-oxo-1-phenyl-2H-pyrrole-4-carbonyl)amino]phenoxy]octanoic acid (PubChem CID 54682796) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is 8-[4-[(3-hydroxy-5-oxo-1-phenyl-2H-pyrrole-4-carbonyl)amino]phenoxy]octanoic acid.
| Compound Name | 8-[4-[(3-hydroxy-5-oxo-1-phenyl-2H-pyrrole-4-carbonyl)amino]phenoxy]octanoic acid |
|---|---|
| PubChem CID | 54682796 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 8-[4-[(3-hydroxy-5-oxo-1-phenyl-2H-pyrrole-4-carbonyl)amino]phenoxy]octanoic acid |
| SMILES | O=C(O)CCCCCCCOc1ccc(NC(=O)C2=C(O)CN(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H28N2O6/c28-21-17-27(19-9-5-4-6-10-19)25(32)23(21)24(31)26-18-12-14-20(15-13-18)33-16-8-3-1-2-7-11-22(29)30/h4-6,9-10,12-15,28H,1-3,7-8,11,16-17H2,(H,26,31)(H,29,30) |
| InChIKey | RNEIERACNKLMMS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|