C25H27ClN6O4 — CID 101158721
1-(4-chlorophenyl)-3-hydroxy-5-oxo-N-[4-[7-(2H-tetrazol-5-yl)heptoxy]phenyl]-2H-pyrrole-4-carboxamide (PubChem CID 101158721) has the molecular formula C25H27ClN6O4 and a molecular weight of 510.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-hydroxy-5-oxo-N-[4-[7-(2H-tetrazol-5-yl)heptoxy]phenyl]-2H-pyrrole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-3-hydroxy-5-oxo-N-[4-[7-(2H-tetrazol-5-yl)heptoxy]phenyl]-2H-pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 101158721 |
| Molecular Formula | C25H27ClN6O4 |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 1-(4-chlorophenyl)-3-hydroxy-5-oxo-N-[4-[7-(2H-tetrazol-5-yl)heptoxy]phenyl]-2H-pyrrole-4-carboxamide |
| SMILES | O=C(Nc1ccc(OCCCCCCCc2nn[nH]n2)cc1)C1=C(O)CN(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C25H27ClN6O4/c26-17-7-11-19(12-8-17)32-16-21(33)23(25(32)35)24(34)27-18-9-13-20(14-10-18)36-15-5-3-1-2-4-6-22-28-30-31-29-22/h7-14,33H,1-6,15-16H2,(H,27,34)(H,28,29,30,31) |
| InChIKey | PXWKGAPKBGKSHZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 133.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|