C27H30N2O8 — CID 54731756
8-[4-[[3-hydroxy-1-(3-methoxycarbonylphenyl)-5-oxo-2H-pyrrole-4-carbonyl]amino]phenoxy]octanoic acid (PubChem CID 54731756) has the molecular formula C27H30N2O8 and a molecular weight of 510.54 g/mol. Its IUPAC name is 8-[4-[[3-hydroxy-1-(3-methoxycarbonylphenyl)-5-oxo-2H-pyrrole-4-carbonyl]amino]phenoxy]octanoic acid.
| Compound Name | 8-[4-[[3-hydroxy-1-(3-methoxycarbonylphenyl)-5-oxo-2H-pyrrole-4-carbonyl]amino]phenoxy]octanoic acid |
|---|---|
| PubChem CID | 54731756 |
| Molecular Formula | C27H30N2O8 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 8-[4-[[3-hydroxy-1-(3-methoxycarbonylphenyl)-5-oxo-2H-pyrrole-4-carbonyl]amino]phenoxy]octanoic acid |
| SMILES | COC(=O)c1cccc(N2CC(O)=C(C(=O)Nc3ccc(OCCCCCCCC(=O)O)cc3)C2=O)c1 |
| InChI | InChI=1S/C27H30N2O8/c1-36-27(35)18-8-7-9-20(16-18)29-17-22(30)24(26(29)34)25(33)28-19-11-13-21(14-12-19)37-15-6-4-2-3-5-10-23(31)32/h7-9,11-14,16,30H,2-6,10,15,17H2,1H3,(H,28,33)(H,31,32) |
| InChIKey | VARMXYGMDYVGES-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|