C23H17N3O3 — CID 134087977
4-anilino-2,5-dioxo-N,1-diphenylpyrrole-3-carboxamide (PubChem CID 134087977) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 4-anilino-2,5-dioxo-N,1-diphenylpyrrole-3-carboxamide.
| Compound Name | 4-anilino-2,5-dioxo-N,1-diphenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 134087977 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-anilino-2,5-dioxo-N,1-diphenylpyrrole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1=C(Nc2ccccc2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C23H17N3O3/c27-21(25-17-12-6-2-7-13-17)19-20(24-16-10-4-1-5-11-16)23(29)26(22(19)28)18-14-8-3-9-15-18/h1-15,24H,(H,25,27) |
| InChIKey | YXWKZWOYXCOTMO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|