C19H11F9N2 — CID 15352261
4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-phenyl-3H-1,5-benzodiazepine (PubChem CID 15352261) has the molecular formula C19H11F9N2 and a molecular weight of 438.29 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-phenyl-3H-1,5-benzodiazepine.
| Compound Name | 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-phenyl-3H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 15352261 |
| Molecular Formula | C19H11F9N2 |
| Molecular Weight | 438.29 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-phenyl-3H-1,5-benzodiazepine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1=Nc2ccccc2N=C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H11F9N2/c20-16(21,17(22,23)18(24,25)19(26,27)28)15-10-14(11-6-2-1-3-7-11)29-12-8-4-5-9-13(12)30-15/h1-9H,10H2 |
| InChIKey | XQFZXIAGVLCRFU-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.29 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|