C13H14P+ — CID 163672631
cyclohexa-2,4-dien-1-ylidene-methyl-phenylphosphanium (PubChem CID 163672631) has the molecular formula C13H14P+ and a molecular weight of 201.23 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-ylidene-methyl-phenylphosphanium.
| Compound Name | cyclohexa-2,4-dien-1-ylidene-methyl-phenylphosphanium |
|---|---|
| PubChem CID | 163672631 |
| Molecular Formula | C13H14P+ |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | cyclohexa-2,4-dien-1-ylidene-methyl-phenylphosphanium |
| SMILES | C[P+](=C1C=CC=CC1)c1ccccc1 |
| InChI | InChI=1S/C13H14P/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-10H,11H2,1H3/q+1 |
| InChIKey | UIFOBLYDYSNWEN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|