C15H15N — CID 145442127
N-[(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]ethanimine (PubChem CID 145442127) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]ethanimine.
| Compound Name | N-[(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]ethanimine |
|---|---|
| PubChem CID | 145442127 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-[(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]ethanimine |
| SMILES | C/C=N/C(=C1/C=CC=CC1)c1ccccc1 |
| InChI | InChI=1S/C15H15N/c1-2-16-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h2-11H,12H2,1H3/b15-14-,16-2+ |
| InChIKey | GVLLXBQUKGXNHO-CDJXTDMUSA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|