C26H31BO2 — CID 143893858
2-[(1E,2Z)-1-cyclohexa-2,4-dien-1-ylidene-3-ethenyl-2-methyl-4-phenylpenta-2,4-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 143893858) has the molecular formula C26H31BO2 and a molecular weight of 386.34 g/mol. Its IUPAC name is 2-[(1E,2Z)-1-cyclohexa-2,4-dien-1-ylidene-3-ethenyl-2-methyl-4-phenylpenta-2,4-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1E,2Z)-1-cyclohexa-2,4-dien-1-ylidene-3-ethenyl-2-methyl-4-phenylpenta-2,4-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 143893858 |
| Molecular Formula | C26H31BO2 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 2-[(1E,2Z)-1-cyclohexa-2,4-dien-1-ylidene-3-ethenyl-2-methyl-4-phenylpenta-2,4-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C/C(C(=C)c1ccccc1)=C(C)/C(B1OC(C)(C)C(C)(C)O1)=C1/C=CC=CC1 |
| InChI | InChI=1S/C26H31BO2/c1-8-23(19(2)21-15-11-9-12-16-21)20(3)24(22-17-13-10-14-18-22)27-28-25(4,5)26(6,7)29-27/h8-17H,1-2,18H2,3-7H3/b23-20-,24-22+ |
| InChIKey | LUFVCXLZWHSXQT-JVVTXYFXSA-N |
| XLogP | 6.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|