C21H20N2 — CID 142293657
N'-[(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]-4-methylbenzenecarboximidamide (PubChem CID 142293657) has the molecular formula C21H20N2 and a molecular weight of 300.41 g/mol. Its IUPAC name is N'-[(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]-4-methylbenzenecarboximidamide.
| Compound Name | N'-[(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142293657 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N'-[(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]-4-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(/C(N)=N/C(=C2/C=CC=CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2/c1-16-12-14-19(15-13-16)21(22)23-20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-10,12-15H,11H2,1H3,(H2,22,23)/b20-18- |
| InChIKey | JJHUMKLLHJPDTQ-ZZEZOPTASA-N |
| XLogP | 4.63 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|