C34H36N2 — CID 145284425
ethane;N'-[(Z)-3-phenyl-1-(7,9,9-trimethylfluoren-2-yl)prop-1-enyl]benzenecarboximidamide (PubChem CID 145284425) has the molecular formula C34H36N2 and a molecular weight of 472.68 g/mol. Its IUPAC name is ethane;N'-[(Z)-3-phenyl-1-(7,9,9-trimethylfluoren-2-yl)prop-1-enyl]benzenecarboximidamide.
| Compound Name | ethane;N'-[(Z)-3-phenyl-1-(7,9,9-trimethylfluoren-2-yl)prop-1-enyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145284425 |
| Molecular Formula | C34H36N2 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | ethane;N'-[(Z)-3-phenyl-1-(7,9,9-trimethylfluoren-2-yl)prop-1-enyl]benzenecarboximidamide |
| SMILES | CC.Cc1ccc2c(c1)C(C)(C)c1cc(C(=C/Cc3ccccc3)/N=C(\N)c3ccccc3)ccc1-2 |
| InChI | InChI=1S/C32H30N2.C2H6/c1-22-14-17-26-27-18-16-25(21-29(27)32(2,3)28(26)20-22)30(19-15-23-10-6-4-7-11-23)34-31(33)24-12-8-5-9-13-24;1-2/h4-14,16-21H,15H2,1-3H3,(H2,33,34);1-2H3/b30-19-; |
| InChIKey | KZYGZMNNLNNZER-KBRSZIRKSA-N |
| XLogP | 8.32 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|