C25H21N — CID 142324142
N-[(E)-[4-(8H-benzo[7]annulen-5-yl)phenyl]-cyclohexa-2,4-dien-1-ylidenemethyl]methanimine (PubChem CID 142324142) has the molecular formula C25H21N and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[(E)-[4-(8H-benzo[7]annulen-5-yl)phenyl]-cyclohexa-2,4-dien-1-ylidenemethyl]methanimine.
| Compound Name | N-[(E)-[4-(8H-benzo[7]annulen-5-yl)phenyl]-cyclohexa-2,4-dien-1-ylidenemethyl]methanimine |
|---|---|
| PubChem CID | 142324142 |
| Molecular Formula | C25H21N |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[(E)-[4-(8H-benzo[7]annulen-5-yl)phenyl]-cyclohexa-2,4-dien-1-ylidenemethyl]methanimine |
| SMILES | C=N/C(=C1/C=CC=CC1)c1ccc(C2=c3ccccc3=CCC=C2)cc1 |
| InChI | InChI=1S/C25H21N/c1-26-25(21-11-3-2-4-12-21)22-17-15-20(16-18-22)24-14-8-6-10-19-9-5-7-13-23(19)24/h2-5,7-11,13-18H,1,6,12H2/b25-21- |
| InChIKey | ZCCRSZRSZCTXEV-DAFNUICNSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|