C57H45N3 — CID 167256765
N'-[(2Z,5Z,7Z)-7-[4-[4-(4-carbazol-9-ylphenyl)phenyl]phenyl]-7-cyclohexa-2,4-dien-1-ylidene-4-methylidene-1-phenylhepta-2,5-dien-3-yl]benzenecarboximidamide (PubChem CID 167256765) has the molecular formula C57H45N3 and a molecular weight of 772.01 g/mol. Its IUPAC name is N'-[(2Z,5Z,7Z)-7-[4-[4-(4-carbazol-9-ylphenyl)phenyl]phenyl]-7-cyclohexa-2,4-dien-1-ylidene-4-methylidene-1-phenylhepta-2,5-dien-3-yl]benzenecarboximidamide.
| Compound Name | N'-[(2Z,5Z,7Z)-7-[4-[4-(4-carbazol-9-ylphenyl)phenyl]phenyl]-7-cyclohexa-2,4-dien-1-ylidene-4-methylidene-1-phenylhepta-2,5-dien-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 167256765 |
| Molecular Formula | C57H45N3 |
| Molecular Weight | 772.01 g/mol |
| Exact Mass | 771.36 |
| IUPAC Name | N'-[(2Z,5Z,7Z)-7-[4-[4-(4-carbazol-9-ylphenyl)phenyl]phenyl]-7-cyclohexa-2,4-dien-1-ylidene-4-methylidene-1-phenylhepta-2,5-dien-3-yl]benzenecarboximidamide |
| SMILES | C=C(/C=C\C(=C1\C=CC=CC1)c1ccc(-c2ccc(-c3ccc(-n4c5ccccc5c5ccccc54)cc3)cc2)cc1)C(=C/Cc1ccccc1)/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C57H45N3/c1-41(54(40-26-42-15-5-2-6-16-42)59-57(58)49-19-9-4-10-20-49)25-39-51(47-17-7-3-8-18-47)48-33-31-45(32-34-48)43-27-29-44(30-28-43)46-35-37-50(38-36-46)60-55-23-13-11-21-52(55)53-22-12-14-24-56(53)60/h2-17,19-25,27-40H,1,18,26H2,(H2,58,59)/b39-25-,51-47+,54-40- |
| InChIKey | DBKATBCXKKSNLA-WQTJHNNDSA-N |
| XLogP | 14.03 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.01 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|