C51H40N2 — CID 91278691
benzhydryl-[[6-[(E)-2-[6-[(E)-3-cyclohexa-2,4-dien-1-ylidene-3-phenylprop-1-enyl]naphthalen-2-yl]ethenyl]naphthalen-2-yl]methyl]diazene (PubChem CID 91278691) has the molecular formula C51H40N2 and a molecular weight of 680.90 g/mol. Its IUPAC name is benzhydryl-[[6-[(E)-2-[6-[(E)-3-cyclohexa-2,4-dien-1-ylidene-3-phenylprop-1-enyl]naphthalen-2-yl]ethenyl]naphthalen-2-yl]methyl]diazene.
| Compound Name | benzhydryl-[[6-[(E)-2-[6-[(E)-3-cyclohexa-2,4-dien-1-ylidene-3-phenylprop-1-enyl]naphthalen-2-yl]ethenyl]naphthalen-2-yl]methyl]diazene |
|---|---|
| PubChem CID | 91278691 |
| Molecular Formula | C51H40N2 |
| Molecular Weight | 680.90 g/mol |
| Exact Mass | 680.32 |
| IUPAC Name | benzhydryl-[[6-[(E)-2-[6-[(E)-3-cyclohexa-2,4-dien-1-ylidene-3-phenylprop-1-enyl]naphthalen-2-yl]ethenyl]naphthalen-2-yl]methyl]diazene |
| SMILES | C1=CCC(=C(/C=C/c2ccc3cc(/C=C/c4ccc5cc(C/N=N/C(c6ccccc6)c6ccccc6)ccc5c4)ccc3c2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C51H40N2/c1-5-13-42(14-6-1)50(43-15-7-2-8-16-43)32-27-40-25-29-46-33-38(23-28-47(46)35-40)21-22-39-24-30-49-36-41(26-31-48(49)34-39)37-52-53-51(44-17-9-3-10-18-44)45-19-11-4-12-20-45/h1-15,17-36,51H,16,37H2/b22-21+,32-27+,50-43?,53-52+ |
| InChIKey | YZTLUPOTAMFTKA-KVHAMKEVSA-N |
| XLogP | 13.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.90 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|