C16H13FeNO4 — CID 11046044
carbon monoxide;iron;(Z)-N-phenylmethoxycyclohexa-2,4-dien-1-imine (PubChem CID 11046044) has the molecular formula C16H13FeNO4 and a molecular weight of 339.13 g/mol. Its IUPAC name is carbon monoxide;iron;(Z)-N-phenylmethoxycyclohexa-2,4-dien-1-imine.
| Compound Name | carbon monoxide;iron;(Z)-N-phenylmethoxycyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 11046044 |
| Molecular Formula | C16H13FeNO4 |
| Molecular Weight | 339.13 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | carbon monoxide;iron;(Z)-N-phenylmethoxycyclohexa-2,4-dien-1-imine |
| SMILES | C1=CC/C(=N/OCc2ccccc2)C=C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C13H13NO.3CO.Fe/c1-3-7-12(8-4-1)11-15-14-13-9-5-2-6-10-13;3*1-2;/h1-9H,10-11H2;;;;/b14-13+;;;; |
| InChIKey | KPRALTJWKLZZSM-XURWPRCOSA-N |
| XLogP | 2.96 |
| TPSA | 81.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|