C15H10Br2 — CID 143834873
5,11-dibromo-10H-cyclohepta[b]naphthalene (PubChem CID 143834873) has the molecular formula C15H10Br2 and a molecular weight of 350.05 g/mol. Its IUPAC name is 5,11-dibromo-10H-cyclohepta[b]naphthalene.
| Compound Name | 5,11-dibromo-10H-cyclohepta[b]naphthalene |
|---|---|
| PubChem CID | 143834873 |
| Molecular Formula | C15H10Br2 |
| Molecular Weight | 350.05 g/mol |
| Exact Mass | 347.91 |
| IUPAC Name | 5,11-dibromo-10H-cyclohepta[b]naphthalene |
| SMILES | Brc1c2c(c(Br)c3ccccc13)CC=CC=C2 |
| InChI | InChI=1S/C15H10Br2/c16-14-10-6-2-1-3-7-11(10)15(17)13-9-5-4-8-12(13)14/h1-6,8-9H,7H2 |
| InChIKey | IACZZVYNLTUFJW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.05 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |