C19H15NS — CID 139498191
4-(10H-cyclohepta[b][1]benzothiol-4-yl)aniline (PubChem CID 139498191) has the molecular formula C19H15NS and a molecular weight of 289.40 g/mol. Its IUPAC name is 4-(10H-cyclohepta[b][1]benzothiol-4-yl)aniline.
| Compound Name | 4-(10H-cyclohepta[b][1]benzothiol-4-yl)aniline |
|---|---|
| PubChem CID | 139498191 |
| Molecular Formula | C19H15NS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-(10H-cyclohepta[b][1]benzothiol-4-yl)aniline |
| SMILES | Nc1ccc(-c2cccc3c4c(sc23)C=CC=CC4)cc1 |
| InChI | InChI=1S/C19H15NS/c20-14-11-9-13(10-12-14)15-6-4-7-17-16-5-2-1-3-8-18(16)21-19(15)17/h1-4,6-12H,5,20H2 |
| InChIKey | PHHGSRRZLDDNRK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|