C21H22S — CID 144907299
14,14-dimethyl-12-prop-2-enyl-9-thiatetracyclo[8.7.0.02,8.011,15]heptadeca-1(10),2(8),4,6,11(15),16-hexaene (PubChem CID 144907299) has the molecular formula C21H22S and a molecular weight of 306.47 g/mol. Its IUPAC name is 14,14-dimethyl-12-prop-2-enyl-9-thiatetracyclo[8.7.0.02,8.011,15]heptadeca-1(10),2(8),4,6,11(15),16-hexaene.
| Compound Name | 14,14-dimethyl-12-prop-2-enyl-9-thiatetracyclo[8.7.0.02,8.011,15]heptadeca-1(10),2(8),4,6,11(15),16-hexaene |
|---|---|
| PubChem CID | 144907299 |
| Molecular Formula | C21H22S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 14,14-dimethyl-12-prop-2-enyl-9-thiatetracyclo[8.7.0.02,8.011,15]heptadeca-1(10),2(8),4,6,11(15),16-hexaene |
| SMILES | C=CCC1CC(C)(C)c2ccc3c4c(sc3c21)C=CC=CC4 |
| InChI | InChI=1S/C21H22S/c1-4-8-14-13-21(2,3)17-12-11-16-15-9-6-5-7-10-18(15)22-20(16)19(14)17/h4-7,10-12,14H,1,8-9,13H2,2-3H3 |
| InChIKey | HIYDKDCAVCCROA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|