C14H18S — CID 142399260
ethane;2-ethenyl-3-methyl-4H-cyclohepta[b]thiophene (PubChem CID 142399260) has the molecular formula C14H18S and a molecular weight of 218.36 g/mol. Its IUPAC name is ethane;2-ethenyl-3-methyl-4H-cyclohepta[b]thiophene.
| Compound Name | ethane;2-ethenyl-3-methyl-4H-cyclohepta[b]thiophene |
|---|---|
| PubChem CID | 142399260 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | ethane;2-ethenyl-3-methyl-4H-cyclohepta[b]thiophene |
| SMILES | C=Cc1sc2c(c1C)CC=CC=C2.CC |
| InChI | InChI=1S/C12H12S.C2H6/c1-3-11-9(2)10-7-5-4-6-8-12(10)13-11;1-2/h3-6,8H,1,7H2,2H3;1-2H3 |
| InChIKey | FNXKNHIWCBYIOK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |