C16H15N3OS — CID 143517948
2-[(6-amino-5-iminocyclohexa-1,3-dien-1-yl)iminomethyl]-4H-cyclohepta[b]thiophen-3-ol (PubChem CID 143517948) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[(6-amino-5-iminocyclohexa-1,3-dien-1-yl)iminomethyl]-4H-cyclohepta[b]thiophen-3-ol.
| Compound Name | 2-[(6-amino-5-iminocyclohexa-1,3-dien-1-yl)iminomethyl]-4H-cyclohepta[b]thiophen-3-ol |
|---|---|
| PubChem CID | 143517948 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-[(6-amino-5-iminocyclohexa-1,3-dien-1-yl)iminomethyl]-4H-cyclohepta[b]thiophen-3-ol |
| SMILES | [H]/N=C1\C=CC=C(/N=C/c2sc3c(c2O)CC=CC=C3)C1N |
| InChI | InChI=1S/C16H15N3OS/c17-11-6-4-7-12(15(11)18)19-9-14-16(20)10-5-2-1-3-8-13(10)21-14/h1-4,6-9,15,17,20H,5,18H2/b17-11+,19-9+ |
| InChIKey | ZSXXLJYTSYKUAK-LAQUFMTMSA-N |
| XLogP | 2.80 |
| TPSA | 82.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|