C15H22S — CID 159148646
2,3-ditert-butyl-4H-cyclopenta[b]thiophene (PubChem CID 159148646) has the molecular formula C15H22S and a molecular weight of 234.41 g/mol. Its IUPAC name is 2,3-ditert-butyl-4H-cyclopenta[b]thiophene.
| Compound Name | 2,3-ditert-butyl-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 159148646 |
| Molecular Formula | C15H22S |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2,3-ditert-butyl-4H-cyclopenta[b]thiophene |
| SMILES | CC(C)(C)c1sc2c(c1C(C)(C)C)CC=C2 |
| InChI | InChI=1S/C15H22S/c1-14(2,3)12-10-8-7-9-11(10)16-13(12)15(4,5)6/h7,9H,8H2,1-6H3 |
| InChIKey | WOFMIHCHGQEVKZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |