About 5,7-ditert-butylthieno[3,4-b]pyrazine
5,7-ditert-butylthieno[3,4-b]pyrazine (PubChem CID 134445588) has the molecular formula C14H20N2S
and a molecular weight of 248.39 g/mol. Its IUPAC name is 5,7-ditert-butylthieno[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 5,7-ditert-butylthieno[3,4-b]pyrazine |
| PubChem CID | 134445588 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 5,7-ditert-butylthieno[3,4-b]pyrazine |
| SMILES | CC(C)(C)c1sc(C(C)(C)C)c2nccnc12 |
| InChI | InChI=1S/C14H20N2S/c1-13(2,3)11-9-10(16-8-7-15-9)12(17-11)14(4,5)6/h7-8H,1-6H3 |
| InChIKey | JRXQKHDWRBGYJV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-ditert-butylthieno[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-ditert-butylthieno[3,4-b]pyrazine?
The IUPAC name of 5,7-ditert-butylthieno[3,4-b]pyrazine (CID 134445588) is 5,7-ditert-butylthieno[3,4-b]pyrazine.
What is the SMILES notation for 5,7-ditert-butylthieno[3,4-b]pyrazine?
The canonical SMILES for 5,7-ditert-butylthieno[3,4-b]pyrazine is CC(C)(C)c1sc(C(C)(C)C)c2nccnc12.
What is the InChIKey of 5,7-ditert-butylthieno[3,4-b]pyrazine?
The InChIKey is JRXQKHDWRBGYJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2S/c1-13(2,3)11-9-10(16-8-7-15-9)12(17-11)14(4,5)6/h7-8H,1-6H3.
What are the key properties of 5,7-ditert-butylthieno[3,4-b]pyrazine?
5,7-ditert-butylthieno[3,4-b]pyrazine has a molecular weight of 248.39 g/mol, XLogP of 4.29, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-ditert-butylthieno[3,4-b]pyrazine is sourced from PubChem (CID 134445588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).