C24H18 — CID 58130571
heptacyclo[16.6.0.02,9.03,7.010,17.011,15.019,23]tetracosa-1,3(7),4,9,11(15),12,17,19(23),20-nonaene (PubChem CID 58130571) has the molecular formula C24H18 and a molecular weight of 306.41 g/mol. Its IUPAC name is heptacyclo[16.6.0.02,9.03,7.010,17.011,15.019,23]tetracosa-1,3(7),4,9,11(15),12,17,19(23),20-nonaene.
| Compound Name | heptacyclo[16.6.0.02,9.03,7.010,17.011,15.019,23]tetracosa-1,3(7),4,9,11(15),12,17,19(23),20-nonaene |
|---|---|
| PubChem CID | 58130571 |
| Molecular Formula | C24H18 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | heptacyclo[16.6.0.02,9.03,7.010,17.011,15.019,23]tetracosa-1,3(7),4,9,11(15),12,17,19(23),20-nonaene |
| SMILES | C1=CC2=C(C1)Cc1c2c2c(c3c1C1=C(CC=C1)C3)C1=C(CC=C1)C2 |
| InChI | InChI=1S/C24H18/c1-4-13-10-19-22(16(13)7-1)20-11-14-5-2-9-18(14)24(20)21-12-15-6-3-8-17(15)23(19)21/h1-3,7-9H,4-6,10-12H2 |
| InChIKey | MALCNVVJZPVASU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |