C15H12 — CID 157493433
tetracyclo[7.6.0.03,7.010,14]pentadeca-1(9),2,5,7,10(14),11-hexaene (PubChem CID 157493433) has the molecular formula C15H12 and a molecular weight of 192.26 g/mol. Its IUPAC name is tetracyclo[7.6.0.03,7.010,14]pentadeca-1(9),2,5,7,10(14),11-hexaene.
| Compound Name | tetracyclo[7.6.0.03,7.010,14]pentadeca-1(9),2,5,7,10(14),11-hexaene |
|---|---|
| PubChem CID | 157493433 |
| Molecular Formula | C15H12 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | tetracyclo[7.6.0.03,7.010,14]pentadeca-1(9),2,5,7,10(14),11-hexaene |
| SMILES | C1=CC2=C(C1)Cc1cc3c(cc12)C=CC3 |
| InChI | InChI=1S/C15H12/c1-3-10-7-13-8-12-5-2-6-14(12)15(13)9-11(10)4-1/h1-2,4,6-7,9H,3,5,8H2 |
| InChIKey | CDTKVQYISCCILN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |