C16H12 — CID 157096961
tetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),12-heptaene (PubChem CID 157096961) has the molecular formula C16H12 and a molecular weight of 204.27 g/mol. Its IUPAC name is tetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),12-heptaene.
| Compound Name | tetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),12-heptaene |
|---|---|
| PubChem CID | 157096961 |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | tetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),12-heptaene |
| SMILES | C1=CC2=C(C1)Cc1cc3ccccc3cc12 |
| InChI | InChI=1S/C16H12/c1-2-5-12-10-16-14(8-11(12)4-1)9-13-6-3-7-15(13)16/h1-5,7-8,10H,6,9H2 |
| InChIKey | XGMYSGZHNDPNMA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |