C13H10O — CID 22341653
3,4-dihydrocyclopenta[a]naphthalen-5-one (PubChem CID 22341653) has the molecular formula C13H10O and a molecular weight of 182.22 g/mol. Its IUPAC name is 3,4-dihydrocyclopenta[a]naphthalen-5-one.
| Compound Name | 3,4-dihydrocyclopenta[a]naphthalen-5-one |
|---|---|
| PubChem CID | 22341653 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 3,4-dihydrocyclopenta[a]naphthalen-5-one |
| SMILES | O=C1CC2=C(C=CC2)c2ccccc21 |
| InChI | InChI=1S/C13H10O/c14-13-8-9-4-3-7-10(9)11-5-1-2-6-12(11)13/h1-3,5-7H,4,8H2 |
| InChIKey | NDSJVQMRBFHTSX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |