C15H10O2S — CID 13450297
benzo[b][1]benzothiocine-10,12-dione (PubChem CID 13450297) has the molecular formula C15H10O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is benzo[b][1]benzothiocine-10,12-dione.
| Compound Name | benzo[b][1]benzothiocine-10,12-dione |
|---|---|
| PubChem CID | 13450297 |
| Molecular Formula | C15H10O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | benzo[b][1]benzothiocine-10,12-dione |
| SMILES | O=C1CC(=O)c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C15H10O2S/c16-12-9-13(17)11-6-2-4-8-15(11)18-14-7-3-1-5-10(12)14/h1-8H,9H2 |
| InChIKey | OCQHVMFLVKGLKY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|