C19H15N3O3S2 — CID 159326659
6-oxo-N-(pyrimidin-5-ylmethyl)-5H-benzo[b][1]benzothiepine-3-sulfonamide (PubChem CID 159326659) has the molecular formula C19H15N3O3S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 6-oxo-N-(pyrimidin-5-ylmethyl)-5H-benzo[b][1]benzothiepine-3-sulfonamide.
| Compound Name | 6-oxo-N-(pyrimidin-5-ylmethyl)-5H-benzo[b][1]benzothiepine-3-sulfonamide |
|---|---|
| PubChem CID | 159326659 |
| Molecular Formula | C19H15N3O3S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 6-oxo-N-(pyrimidin-5-ylmethyl)-5H-benzo[b][1]benzothiepine-3-sulfonamide |
| SMILES | O=C1Cc2cc(S(=O)(=O)NCc3cncnc3)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C19H15N3O3S2/c23-17-8-14-7-15(27(24,25)22-11-13-9-20-12-21-10-13)5-6-18(14)26-19-4-2-1-3-16(17)19/h1-7,9-10,12,22H,8,11H2 |
| InChIKey | LELGZOCZXIOIOB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |