About 2H-naphthalen-1-one;hydrobromide
2H-naphthalen-1-one;hydrobromide (PubChem CID 21419388) has the molecular formula C10H9BrO
and a molecular weight of 225.09 g/mol. Its IUPAC name is 2H-naphthalen-1-one;hydrobromide.
Molecular Properties
| Compound Name | 2H-naphthalen-1-one;hydrobromide |
| PubChem CID | 21419388 |
| Molecular Formula | C10H9BrO |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | 2H-naphthalen-1-one;hydrobromide |
| SMILES | Br.O=C1CC=Cc2ccccc21 |
| InChI | InChI=1S/C10H8O.BrH/c11-10-7-3-5-8-4-1-2-6-9(8)10;/h1-6H,7H2;1H |
| InChIKey | CKHBZUDDXHAQLE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-naphthalen-1-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-naphthalen-1-one;hydrobromide?
The IUPAC name of 2H-naphthalen-1-one;hydrobromide (CID 21419388) is 2H-naphthalen-1-one;hydrobromide.
What is the SMILES notation for 2H-naphthalen-1-one;hydrobromide?
The canonical SMILES for 2H-naphthalen-1-one;hydrobromide is Br.O=C1CC=Cc2ccccc21.
What is the InChIKey of 2H-naphthalen-1-one;hydrobromide?
The InChIKey is CKHBZUDDXHAQLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.BrH/c11-10-7-3-5-8-4-1-2-6-9(8)10;/h1-6H,7H2;1H.
What are the key properties of 2H-naphthalen-1-one;hydrobromide?
2H-naphthalen-1-one;hydrobromide has a molecular weight of 225.09 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-naphthalen-1-one;hydrobromide is sourced from PubChem (CID 21419388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).