About 1-diazo-2H-naphthalene;nitrobenzene
1-diazo-2H-naphthalene;nitrobenzene (PubChem CID 175312965) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is 1-diazo-2H-naphthalene;nitrobenzene.
Molecular Properties
| Compound Name | 1-diazo-2H-naphthalene;nitrobenzene |
| PubChem CID | 175312965 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-diazo-2H-naphthalene;nitrobenzene |
| SMILES | O=[N+]([O-])c1ccccc1.[N-]=[N+]=C1CC=Cc2ccccc21 |
| InChI | InChI=1S/C10H8N2.C6H5NO2/c11-12-10-7-3-5-8-4-1-2-6-9(8)10;8-7(9)6-4-2-1-3-5-6/h1-6H,7H2;1-5H |
| InChIKey | HTMYBGSQUBLUFQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-diazo-2H-naphthalene;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazo-2H-naphthalene;nitrobenzene?
The IUPAC name of 1-diazo-2H-naphthalene;nitrobenzene (CID 175312965) is 1-diazo-2H-naphthalene;nitrobenzene.
What is the SMILES notation for 1-diazo-2H-naphthalene;nitrobenzene?
The canonical SMILES for 1-diazo-2H-naphthalene;nitrobenzene is O=[N+]([O-])c1ccccc1.[N-]=[N+]=C1CC=Cc2ccccc21.
What is the InChIKey of 1-diazo-2H-naphthalene;nitrobenzene?
The InChIKey is HTMYBGSQUBLUFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C6H5NO2/c11-12-10-7-3-5-8-4-1-2-6-9(8)10;8-7(9)6-4-2-1-3-5-6/h1-6H,7H2;1-5H.
What are the key properties of 1-diazo-2H-naphthalene;nitrobenzene?
1-diazo-2H-naphthalene;nitrobenzene has a molecular weight of 279.30 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazo-2H-naphthalene;nitrobenzene is sourced from PubChem (CID 175312965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).