C25H36 — CID 144712628
1,2,3,4,5-pentamethyl-6-(2-methylcyclopenta-1,4-dien-1-yl)benzene;2,3,4-trimethylpenta-1,3-diene (PubChem CID 144712628) has the molecular formula C25H36 and a molecular weight of 336.56 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-(2-methylcyclopenta-1,4-dien-1-yl)benzene;2,3,4-trimethylpenta-1,3-diene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-(2-methylcyclopenta-1,4-dien-1-yl)benzene;2,3,4-trimethylpenta-1,3-diene |
|---|---|
| PubChem CID | 144712628 |
| Molecular Formula | C25H36 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-(2-methylcyclopenta-1,4-dien-1-yl)benzene;2,3,4-trimethylpenta-1,3-diene |
| SMILES | C=C(C)C(C)=C(C)C.CC1=C(c2c(C)c(C)c(C)c(C)c2C)C=CC1 |
| InChI | InChI=1S/C17H22.C8H14/c1-10-8-7-9-16(10)17-14(5)12(3)11(2)13(4)15(17)6;1-6(2)8(5)7(3)4/h7,9H,8H2,1-6H3;1H2,2-5H3 |
| InChIKey | DUVAGRQLDDNVSR-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|